Pentamethylene nitrate

CAS No: 3457-92-9

3457-92-9
56104-03-1 gamma-glutamyl dopamine
29633-99-6 N-Acetylaminophenyl icsysnar acid /D-(-) isomer
29632-41-5 N-[2-(4-cyclopropylphenyl)-2-hydroxyethyl]propan-2-aminium chloride
56113-42-9 TETRACHLOROPHTHALICACIDMONOAMIDE
56120-91-3 Trisiloxane, 3-methoxy-1,1,1,5,5,5-hexamethyl-3-[(trimethylsilyl)oxy]-
3457-77-0 1H-Indene-2-carboxylic acid, 2,3-dihydro-1,3-dioxo-, ethyl ester
29634-37-5 o-Hydroxyphenylbenzyl sulfone
3457-92-9 Pentamethylene nitrate
56113-24-7 dipotassium 9,10-dihydro-1,8-dihydroxy-4,5-dinitro-9,10-dioxoanthracene-2,7-disulphonate
29197-96-4 Coumarin, 3-phenyl-4-methyl-7-diethylamino-
56114-38-6 1,2-Dihydro-1-(1,2,3,4,5,6-hexahydroxyhexyl)-8-apo-ψ,ψ-caroten-8-oic acid methyl ester
3457-90-7 DIPROPYLENEGLYCOL1,3-DINITRATE
2963-42-0 b-Alanine, N-(2-chloro-4-nitrophenyl)-
34579-88-9 Phenol, 2,2'-[1,4-phenylenebis(iminomethylene)]bis-
29634-36-4 2-(Isopentylsulfonyl)phenol
29634-32-0 o-(Butylsulfonyl)phenol
56113-25-8 9,10-dihydroanthracene-1,4,5,8,9,10-hexol
34580-64-8 [[1-[3-(Trifluoromethyl)phenyl]-1H-pyrazolo[3,4-b]pyridin-3-yl]oxy]acetic acid
34580-10-4 9,10-DIBROMO-9,10-DIHYDRO-4H-BENZO(4,5)CYCLOHEPTA(1,2-B)THIOPHENE-4-ONE
5612-13-5 Hexanoic acid, 6-[(triphenylmethyl)amino]-
3457-92-9 pentamethylene,nitrate,3457-92-9
2025-10-22 Discover Pentamethylene nitrate (CAS No: 3457-92-9) and related compounds. Ideal for advanced chemical applications. Competitive pricing, fast delivery, and expert support worldwide.